C7H13NOS2 — CID 131187285
N-(2,2-dimethylthietan-3-yl)-2-sulfanylacetamide (PubChem CID 131187285) has the molecular formula C7H13NOS2 and a molecular weight of 191.32 g/mol. Its IUPAC name is N-(2,2-dimethylthietan-3-yl)-2-sulfanylacetamide.
| Compound Name | N-(2,2-dimethylthietan-3-yl)-2-sulfanylacetamide |
|---|---|
| PubChem CID | 131187285 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | N-(2,2-dimethylthietan-3-yl)-2-sulfanylacetamide |
| SMILES | CC1(C)SCC1NC(=O)CS |
| InChI | InChI=1S/C7H13NOS2/c1-7(2)5(4-11-7)8-6(9)3-10/h5,10H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | PJFUMAWQCSDKAD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|