C16H14ClF3N4O2 — CID 109252168
[2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-5-yl]-morpholin-4-ylmethanone (PubChem CID 109252168) has the molecular formula C16H14ClF3N4O2 and a molecular weight of 386.76 g/mol. Its IUPAC name is [2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109252168 |
| Molecular Formula | C16H14ClF3N4O2 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(Nc2cc(C(F)(F)F)ccc2Cl)nc1)N1CCOCC1 |
| InChI | InChI=1S/C16H14ClF3N4O2/c17-12-2-1-11(16(18,19)20)7-13(12)23-15-21-8-10(9-22-15)14(25)24-3-5-26-6-4-24/h1-2,7-9H,3-6H2,(H,21,22,23) |
| InChIKey | BTDKQSZHABCXHU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |