C21H17ClF3N3O2 — CID 53052655
[4-[2-chloro-5-(trifluoromethyl)anilino]quinolin-3-yl]-morpholin-4-ylmethanone (PubChem CID 53052655) has the molecular formula C21H17ClF3N3O2 and a molecular weight of 435.83 g/mol. Its IUPAC name is [4-[2-chloro-5-(trifluoromethyl)anilino]quinolin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-chloro-5-(trifluoromethyl)anilino]quinolin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 53052655 |
| Molecular Formula | C21H17ClF3N3O2 |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [4-[2-chloro-5-(trifluoromethyl)anilino]quinolin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc2ccccc2c1Nc1cc(C(F)(F)F)ccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C21H17ClF3N3O2/c22-16-6-5-13(21(23,24)25)11-18(16)27-19-14-3-1-2-4-17(14)26-12-15(19)20(29)28-7-9-30-10-8-28/h1-6,11-12H,7-10H2,(H,26,27) |
| InChIKey | OVNSVCWYCGMZBX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |