C20H13N5O6S2 — CID 41226958
N-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 41226958) has the molecular formula C20H13N5O6S2 and a molecular weight of 483.49 g/mol. Its IUPAC name is N-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 41226958 |
| Molecular Formula | C20H13N5O6S2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | N-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]-1,3-thiazol-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccc3c(c2)OCO3)n1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C20H13N5O6S2/c26-17(23-20-22-13-3-2-12(25(28)29)7-16(13)33-20)6-11-8-32-19(21-11)24-18(27)10-1-4-14-15(5-10)31-9-30-14/h1-5,7-8H,6,9H2,(H,21,24,27)(H,22,23,26) |
| InChIKey | ZZRXVWNLFDJAMS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|