C22H20N6O4S — CID 112816807
N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 112816807) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 112816807 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-[4-[4-(3-acetamidopropyl)phenyl]-1,3-thiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CC(=O)NCCCc1ccc(-c2csc(NC(=O)c3n[nH]c4ccc([N+](=O)[O-])cc34)n2)cc1 |
| InChI | InChI=1S/C22H20N6O4S/c1-13(29)23-10-2-3-14-4-6-15(7-5-14)19-12-33-22(24-19)25-21(30)20-17-11-16(28(31)32)8-9-18(17)26-27-20/h4-9,11-12H,2-3,10H2,1H3,(H,23,29)(H,26,27)(H,24,25,30) |
| InChIKey | QRIXURLETHAQPS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|