C11H9N7O5S2 — CID 55979677
N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 55979677) has the molecular formula C11H9N7O5S2 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 55979677 |
| Molecular Formula | C11H9N7O5S2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1nnc(NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)s1 |
| InChI | InChI=1S/C11H9N7O5S2/c1-25(22,23)17-11-16-15-10(24-11)12-9(19)8-6-4-5(18(20)21)2-3-7(6)13-14-8/h2-4H,1H3,(H,13,14)(H,16,17)(H,12,15,19) |
| InChIKey | OMAHKIYNJFZFEE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 172.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|