C17H10F3N5O4S — CID 78869403
5-nitro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]-1H-indazole-3-carboxamide (PubChem CID 78869403) has the molecular formula C17H10F3N5O4S and a molecular weight of 437.36 g/mol. Its IUPAC name is 5-nitro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | 5-nitro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78869403 |
| Molecular Formula | C17H10F3N5O4S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 5-nitro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(OCC(F)(F)F)cc2s1)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H10F3N5O4S/c18-17(19,20)7-29-9-2-4-12-13(6-9)30-16(21-12)22-15(26)14-10-5-8(25(27)28)1-3-11(10)23-24-14/h1-6H,7H2,(H,23,24)(H,21,22,26) |
| InChIKey | PTZVIKKAPYKXBG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|