C15H8Cl2F3N3O2S — CID 55675885
5,6-dichloro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide (PubChem CID 55675885) has the molecular formula C15H8Cl2F3N3O2S and a molecular weight of 422.22 g/mol. Its IUPAC name is 5,6-dichloro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55675885 |
| Molecular Formula | C15H8Cl2F3N3O2S |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 5,6-dichloro-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc(OCC(F)(F)F)cc2s1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H8Cl2F3N3O2S/c16-9-3-7(5-21-12(9)17)13(24)23-14-22-10-2-1-8(4-11(10)26-14)25-6-15(18,19)20/h1-5H,6H2,(H,22,23,24) |
| InChIKey | NXIULCHVWWYJJJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|