C16H15N5O5S — CID 90747946
N-[4-methyl-2-(sulfamoylmethyl)phenyl]-5-nitro-1H-indazole-3-carboxamide (PubChem CID 90747946) has the molecular formula C16H15N5O5S and a molecular weight of 389.39 g/mol. Its IUPAC name is N-[4-methyl-2-(sulfamoylmethyl)phenyl]-5-nitro-1H-indazole-3-carboxamide.
| Compound Name | N-[4-methyl-2-(sulfamoylmethyl)phenyl]-5-nitro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 90747946 |
| Molecular Formula | C16H15N5O5S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[4-methyl-2-(sulfamoylmethyl)phenyl]-5-nitro-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)c(CS(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H15N5O5S/c1-9-2-4-13(10(6-9)8-27(17,25)26)18-16(22)15-12-7-11(21(23)24)3-5-14(12)19-20-15/h2-7H,8H2,1H3,(H,18,22)(H,19,20)(H2,17,25,26) |
| InChIKey | WXKTZNHMCIYPGD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|