C18H14N4OS — CID 40672202
N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1H-indazole-3-carboxamide (PubChem CID 40672202) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 40672202 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3n[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C18H14N4OS/c1-11-6-8-12(9-7-11)15-10-24-18(19-15)20-17(23)16-13-4-2-3-5-14(13)21-22-16/h2-10H,1H3,(H,21,22)(H,19,20,23) |
| InChIKey | OLZMAVFWLWCGQW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |