C13H12N4OS — CID 166229758
N-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-indazole-3-carboxamide (PubChem CID 166229758) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 166229758 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(2,4-dimethyl-1,3-thiazol-5-yl)-1H-indazole-3-carboxamide |
| SMILES | Cc1nc(C)c(NC(=O)c2n[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C13H12N4OS/c1-7-13(19-8(2)14-7)15-12(18)11-9-5-3-4-6-10(9)16-17-11/h3-6H,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | CYIKYKLKPIWLOF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |