C19H10ClN3O4S — CID 155528570
2-chloro-3-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]naphthalene-1,4-dione (PubChem CID 155528570) has the molecular formula C19H10ClN3O4S and a molecular weight of 411.83 g/mol. Its IUPAC name is 2-chloro-3-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 155528570 |
| Molecular Formula | C19H10ClN3O4S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 2-chloro-3-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H10ClN3O4S/c20-15-16(18(25)13-4-2-1-3-12(13)17(15)24)22-19-21-14(9-28-19)10-5-7-11(8-6-10)23(26)27/h1-9H,(H,21,22) |
| InChIKey | LTCZMJDQCKEPJU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|