C24H25N3O5S2 — CID 55661997
(E)-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enamide (PubChem CID 55661997) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is (E)-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55661997 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (E)-N-[4-[4-(dimethylsulfamoyl)phenyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)Nc2nc(-c3ccc(S(=O)(=O)N(C)C)cc3)cs2)cc1OC |
| InChI | InChI=1S/C24H25N3O5S2/c1-5-14-32-21-12-6-17(15-22(21)31-4)7-13-23(28)26-24-25-20(16-33-24)18-8-10-19(11-9-18)34(29,30)27(2)3/h5-13,15-16H,1,14H2,2-4H3,(H,25,26,28)/b13-7+ |
| InChIKey | HQHRTTPMPGMHKL-NTUHNPAUSA-N |
| XLogP | 4.29 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|