C17H16BN3O2S — CID 168578894
[3-methyl-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 168578894) has the molecular formula C17H16BN3O2S and a molecular weight of 337.21 g/mol. Its IUPAC name is [3-methyl-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [3-methyl-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168578894 |
| Molecular Formula | C17H16BN3O2S |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [3-methyl-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | Cc1cc(B(O)O)ccc1C=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H16BN3O2S/c1-12-9-15(18(22)23)8-7-14(12)10-19-21-17-20-16(11-24-17)13-5-3-2-4-6-13/h2-11,22-23H,1H3,(H,20,21) |
| InChIKey | GLZFQDPCTGTEKT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|