C21H20BrN3O4S — CID 168578302
methyl 2-[5-bromo-2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 168578302) has the molecular formula C21H20BrN3O4S and a molecular weight of 490.38 g/mol. Its IUPAC name is methyl 2-[5-bromo-2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 168578302 |
| Molecular Formula | C21H20BrN3O4S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | methyl 2-[5-bromo-2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=NNc2nc(-c3ccccc3)cs2)c(Br)cc1OCC(=O)OC |
| InChI | InChI=1S/C21H20BrN3O4S/c1-3-28-18-9-15(16(22)10-19(18)29-12-20(26)27-2)11-23-25-21-24-17(13-30-21)14-7-5-4-6-8-14/h4-11,13H,3,12H2,1-2H3,(H,24,25) |
| InChIKey | PVKIXJGBQQBVGT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|