C21H27BrN4O3S — CID 168618941
2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-cyclohexylacetamide (PubChem CID 168618941) has the molecular formula C21H27BrN4O3S and a molecular weight of 495.44 g/mol. Its IUPAC name is 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-cyclohexylacetamide.
| Compound Name | 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 168618941 |
| Molecular Formula | C21H27BrN4O3S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[5-bromo-2-ethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenoxy]-N-cyclohexylacetamide |
| SMILES | CCOc1cc(C=NNc2nc(C)cs2)c(Br)cc1OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H27BrN4O3S/c1-3-28-18-9-15(11-23-26-21-24-14(2)13-30-21)17(22)10-19(18)29-12-20(27)25-16-7-5-4-6-8-16/h9-11,13,16H,3-8,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | CCVIEXWJJWSYIE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|