C16H13ClN4O5 — CID 126256356
N-[(E)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 126256356) has the molecular formula C16H13ClN4O5 and a molecular weight of 376.76 g/mol. Its IUPAC name is N-[(E)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 126256356 |
| Molecular Formula | C16H13ClN4O5 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | NC(=O)COc1ccc(Cl)cc1/C=N/NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13ClN4O5/c17-12-3-6-14(26-9-15(18)22)11(7-12)8-19-20-16(23)10-1-4-13(5-2-10)21(24)25/h1-8H,9H2,(H2,18,22)(H,20,23)/b19-8+ |
| InChIKey | LNUDZPQNHDRTTC-UFWORHAWSA-N |
| XLogP | 1.88 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|