C13H19NO4 — CID 10562827
(Z)-N-propan-2-yloxy-1-(2,4,6-trimethoxyphenyl)methanimine (PubChem CID 10562827) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is (Z)-N-propan-2-yloxy-1-(2,4,6-trimethoxyphenyl)methanimine.
| Compound Name | (Z)-N-propan-2-yloxy-1-(2,4,6-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 10562827 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (Z)-N-propan-2-yloxy-1-(2,4,6-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(OC)c(/C=N\OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-9(2)18-14-8-11-12(16-4)6-10(15-3)7-13(11)17-5/h6-9H,1-5H3/b14-8- |
| InChIKey | XFDFUTDQEQUUQH-ZSOIEALJSA-N |
| XLogP | 2.47 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|