C9H10N6O6 — CID 173236987
1,1-diamino-N-[(2-methoxy-3,5-dinitrophenyl)methylideneamino]methanimine oxide (PubChem CID 173236987) has the molecular formula C9H10N6O6 and a molecular weight of 298.22 g/mol. Its IUPAC name is 1,1-diamino-N-[(2-methoxy-3,5-dinitrophenyl)methylideneamino]methanimine oxide.
| Compound Name | 1,1-diamino-N-[(2-methoxy-3,5-dinitrophenyl)methylideneamino]methanimine oxide |
|---|---|
| PubChem CID | 173236987 |
| Molecular Formula | C9H10N6O6 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1,1-diamino-N-[(2-methoxy-3,5-dinitrophenyl)methylideneamino]methanimine oxide |
| SMILES | COc1c(C=N[N+]([O-])=C(N)N)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N6O6/c1-21-8-5(4-12-13(16)9(10)11)2-6(14(17)18)3-7(8)15(19)20/h2-4H,10-11H2,1H3 |
| InChIKey | TVKQHTAUOHSHGH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|