C8H7N3O7 — CID 134879641
2-methoxy-1,5-dinitro-3-(nitromethyl)benzene (PubChem CID 134879641) has the molecular formula C8H7N3O7 and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-methoxy-1,5-dinitro-3-(nitromethyl)benzene.
| Compound Name | 2-methoxy-1,5-dinitro-3-(nitromethyl)benzene |
|---|---|
| PubChem CID | 134879641 |
| Molecular Formula | C8H7N3O7 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-methoxy-1,5-dinitro-3-(nitromethyl)benzene |
| SMILES | COc1c(C[N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O7/c1-18-8-5(4-9(12)13)2-6(10(14)15)3-7(8)11(16)17/h2-3H,4H2,1H3 |
| InChIKey | KTEYMQJJEMVMED-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 138.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|