C8H5F3N2O6S — CID 11909073
2-methoxy-1,5-dinitro-3-[(R)-trifluoromethylsulfinyl]benzene (PubChem CID 11909073) has the molecular formula C8H5F3N2O6S and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-methoxy-1,5-dinitro-3-[(R)-trifluoromethylsulfinyl]benzene.
| Compound Name | 2-methoxy-1,5-dinitro-3-[(R)-trifluoromethylsulfinyl]benzene |
|---|---|
| PubChem CID | 11909073 |
| Molecular Formula | C8H5F3N2O6S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-methoxy-1,5-dinitro-3-[(R)-trifluoromethylsulfinyl]benzene |
| SMILES | COc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[S@@](=O)C(F)(F)F |
| InChI | InChI=1S/C8H5F3N2O6S/c1-19-7-5(13(16)17)2-4(12(14)15)3-6(7)20(18)8(9,10)11/h2-3H,1H3/t20-/m1/s1 |
| InChIKey | QNYCXBXQHOTFMV-HXUWFJFHSA-N |
| XLogP | 2.14 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|