C26H30N4O12 — CID 24740350
methyl 2-[2-methoxy-6-[(E)-[(E)-[3-methoxy-2-(1-methoxy-1-oxobutan-2-yl)oxy-5-nitrophenyl]methylidenehydrazinylidene]methyl]-4-nitrophenoxy]butanoate (PubChem CID 24740350) has the molecular formula C26H30N4O12 and a molecular weight of 590.54 g/mol. Its IUPAC name is methyl 2-[2-methoxy-6-[(E)-[(E)-[3-methoxy-2-(1-methoxy-1-oxobutan-2-yl)oxy-5-nitrophenyl]methylidenehydrazinylidene]methyl]-4-nitrophenoxy]butanoate.
| Compound Name | methyl 2-[2-methoxy-6-[(E)-[(E)-[3-methoxy-2-(1-methoxy-1-oxobutan-2-yl)oxy-5-nitrophenyl]methylidenehydrazinylidene]methyl]-4-nitrophenoxy]butanoate |
|---|---|
| PubChem CID | 24740350 |
| Molecular Formula | C26H30N4O12 |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | methyl 2-[2-methoxy-6-[(E)-[(E)-[3-methoxy-2-(1-methoxy-1-oxobutan-2-yl)oxy-5-nitrophenyl]methylidenehydrazinylidene]methyl]-4-nitrophenoxy]butanoate |
| SMILES | CCC(Oc1c(/C=N/N=C/c2cc([N+](=O)[O-])cc(OC)c2OC(CC)C(=O)OC)cc([N+](=O)[O-])cc1OC)C(=O)OC |
| InChI | InChI=1S/C26H30N4O12/c1-7-19(25(31)39-5)41-23-15(9-17(29(33)34)11-21(23)37-3)13-27-28-14-16-10-18(30(35)36)12-22(38-4)24(16)42-20(8-2)26(32)40-6/h9-14,19-20H,7-8H2,1-6H3/b27-13+,28-14+ |
| InChIKey | OACYJKKGQVWHCX-OCHFTUDZSA-N |
| XLogP | 3.63 |
| TPSA | 200.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|