C15H14N4O9S — CID 168621164
2-[2-[[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168621164) has the molecular formula C15H14N4O9S and a molecular weight of 426.36 g/mol. Its IUPAC name is 2-[2-[[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168621164 |
| Molecular Formula | C15H14N4O9S |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-[2-[[2-(carboxymethoxy)-3-methoxy-5-nitrophenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | COc1cc([N+](=O)[O-])cc(C=NN=C2NC(=O)C(CC(=O)O)S2)c1OCC(=O)O |
| InChI | InChI=1S/C15H14N4O9S/c1-27-9-3-8(19(25)26)2-7(13(9)28-6-12(22)23)5-16-18-15-17-14(24)10(29-15)4-11(20)21/h2-3,5,10H,4,6H2,1H3,(H,20,21)(H,22,23)(H,17,18,24) |
| InChIKey | YZNBPOMPNGVOJE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 190.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|