C18H19IN4O5 — CID 135567832
N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(4-iodoanilino)butanamide (PubChem CID 135567832) has the molecular formula C18H19IN4O5 and a molecular weight of 498.28 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(4-iodoanilino)butanamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(4-iodoanilino)butanamide |
|---|---|
| PubChem CID | 135567832 |
| Molecular Formula | C18H19IN4O5 |
| Molecular Weight | 498.28 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(4-iodoanilino)butanamide |
| SMILES | CCC(Nc1ccc(I)cc1)C(=O)N/N=C/c1cc([N+](=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C18H19IN4O5/c1-3-15(21-13-6-4-12(19)5-7-13)18(25)22-20-10-11-8-14(23(26)27)9-16(28-2)17(11)24/h4-10,15,21,24H,3H2,1-2H3,(H,22,25)/b20-10+ |
| InChIKey | IHQZJXJEGVAXKB-KEBDBYFISA-N |
| XLogP | 3.25 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|