C9H5F2NO — CID 139533736
2,4-difluoro-5-formyl-3-methylbenzonitrile (PubChem CID 139533736) has the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. Its IUPAC name is 2,4-difluoro-5-formyl-3-methylbenzonitrile.
| Compound Name | 2,4-difluoro-5-formyl-3-methylbenzonitrile |
|---|---|
| PubChem CID | 139533736 |
| Molecular Formula | C9H5F2NO |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2,4-difluoro-5-formyl-3-methylbenzonitrile |
| SMILES | Cc1c(F)c(C#N)cc(C=O)c1F |
| InChI | InChI=1S/C9H5F2NO/c1-5-8(10)6(3-12)2-7(4-13)9(5)11/h2,4H,1H3 |
| InChIKey | OIADRUSECLIJKJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|