C21H20F2N2O7 — CID 43055210
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-methylprop-2-enamide (PubChem CID 43055210) has the molecular formula C21H20F2N2O7 and a molecular weight of 450.39 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 43055210 |
| Molecular Formula | C21H20F2N2O7 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)Cc2ccc3c(c2)OCCO3)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H20F2N2O7/c1-24(12-13-3-5-16-18(9-13)31-8-7-30-16)20(26)6-4-14-10-17(29-2)19(32-21(22)23)11-15(14)25(27)28/h3-6,9-11,21H,7-8,12H2,1-2H3/b6-4+ |
| InChIKey | PRAMTKMGJVKBCR-GQCTYLIASA-N |
| XLogP | 3.65 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|