C19H15F2NO7 — CID 24580414
(4-acetylphenyl) (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-enoate (PubChem CID 24580414) has the molecular formula C19H15F2NO7 and a molecular weight of 407.33 g/mol. Its IUPAC name is (4-acetylphenyl) (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-enoate.
| Compound Name | (4-acetylphenyl) (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 24580414 |
| Molecular Formula | C19H15F2NO7 |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (4-acetylphenyl) (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc(C(C)=O)cc2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C19H15F2NO7/c1-11(23)12-3-6-14(7-4-12)28-18(24)8-5-13-9-16(27-2)17(29-19(20)21)10-15(13)22(25)26/h3-10,19H,1-2H3/b8-5+ |
| InChIKey | VAXIJFMPBOPYPQ-VMPITWQZSA-N |
| XLogP | 4.03 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|