C21H18F2N4O5 — CID 24617871
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 24617871) has the molecular formula C21H18F2N4O5 and a molecular weight of 444.39 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24617871 |
| Molecular Formula | C21H18F2N4O5 |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(1-phenylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cnn(-c3ccccc3)c2)c([N+](=O)[O-])cc1OC(F)F |
| InChI | InChI=1S/C21H18F2N4O5/c1-31-18-9-15(17(27(29)30)10-19(18)32-21(22)23)7-8-20(28)24-11-14-12-25-26(13-14)16-5-3-2-4-6-16/h2-10,12-13,21H,11H2,1H3,(H,24,28)/b8-7+ |
| InChIKey | YQEHFYMROXZYRR-BQYQJAHWSA-N |
| XLogP | 3.72 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|