C14H15NaO4 — CID 23662890
sodium (2Z,4E)-5-(2,4-dimethoxyphenyl)-3-methylpenta-2,4-dienoate (PubChem CID 23662890) has the molecular formula C14H15NaO4 and a molecular weight of 270.26 g/mol. Its IUPAC name is sodium (2Z,4E)-5-(2,4-dimethoxyphenyl)-3-methylpenta-2,4-dienoate.
| Compound Name | sodium (2Z,4E)-5-(2,4-dimethoxyphenyl)-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 23662890 |
| Molecular Formula | C14H15NaO4 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | sodium (2Z,4E)-5-(2,4-dimethoxyphenyl)-3-methylpenta-2,4-dienoate |
| SMILES | COc1ccc(/C=C/C(C)=C\C(=O)[O-])c(OC)c1.[Na+] |
| InChI | InChI=1S/C14H16O4.Na/c1-10(8-14(15)16)4-5-11-6-7-12(17-2)9-13(11)18-3;/h4-9H,1-3H3,(H,15,16);/q;+1/p-1/b5-4+,10-8-; |
| InChIKey | GCPCDXHAIRTMHW-FLFOIRSLSA-M |
| XLogP | -1.58 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|