C26H16N2O6 — CID 19197416
[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 19197416) has the molecular formula C26H16N2O6 and a molecular weight of 452.42 g/mol. Its IUPAC name is [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19197416 |
| Molecular Formula | C26H16N2O6 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | COC(=O)/C(C#N)=C/c1cccc(OC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c1 |
| InChI | InChI=1S/C26H16N2O6/c1-33-25(31)18(15-27)12-16-6-4-9-20(13-16)34-26(32)17-7-5-8-19(14-17)28-23(29)21-10-2-3-11-22(21)24(28)30/h2-14H,1H3/b18-12+ |
| InChIKey | VZUDLWRLUXSLFS-LDADJPATSA-N |
| XLogP | 3.79 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|