C12H18O4 — CID 58235144
2-[3-(hydroxymethyl)-4-(2-methoxyethoxy)phenyl]ethanol (PubChem CID 58235144) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)-4-(2-methoxyethoxy)phenyl]ethanol.
| Compound Name | 2-[3-(hydroxymethyl)-4-(2-methoxyethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 58235144 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-[3-(hydroxymethyl)-4-(2-methoxyethoxy)phenyl]ethanol |
| SMILES | COCCOc1ccc(CCO)cc1CO |
| InChI | InChI=1S/C12H18O4/c1-15-6-7-16-12-3-2-10(4-5-13)8-11(12)9-14/h2-3,8,13-14H,4-7,9H2,1H3 |
| InChIKey | SPQQKRFIGQYVJO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|