C24H38O5Si2 — CID 160591805
[5-[2-[[2-(3,4-dimethoxyphenyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol (PubChem CID 160591805) has the molecular formula C24H38O5Si2 and a molecular weight of 462.74 g/mol. Its IUPAC name is [5-[2-[[2-(3,4-dimethoxyphenyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol.
| Compound Name | [5-[2-[[2-(3,4-dimethoxyphenyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 160591805 |
| Molecular Formula | C24H38O5Si2 |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | [5-[2-[[2-(3,4-dimethoxyphenyl)ethyl-dimethylsilyl]oxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol |
| SMILES | COc1ccc(CC[Si](C)(C)O[Si](C)(C)CCc2ccc(OC)c(OC)c2)cc1CO |
| InChI | InChI=1S/C24H38O5Si2/c1-26-22-10-8-19(16-21(22)18-25)12-14-30(4,5)29-31(6,7)15-13-20-9-11-23(27-2)24(17-20)28-3/h8-11,16-17,25H,12-15,18H2,1-7H3 |
| InChIKey | XVFHMHQKGIFILO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|