C22H34O5Si2 — CID 161479494
[5-[2-[2-(3,4-dimethoxyphenyl)ethylsilyloxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol (PubChem CID 161479494) has the molecular formula C22H34O5Si2 and a molecular weight of 434.68 g/mol. Its IUPAC name is [5-[2-[2-(3,4-dimethoxyphenyl)ethylsilyloxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol.
| Compound Name | [5-[2-[2-(3,4-dimethoxyphenyl)ethylsilyloxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 161479494 |
| Molecular Formula | C22H34O5Si2 |
| Molecular Weight | 434.68 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [5-[2-[2-(3,4-dimethoxyphenyl)ethylsilyloxy-dimethylsilyl]ethyl]-2-methoxyphenyl]methanol |
| SMILES | COc1ccc(CC[Si](C)(C)O[SiH2]CCc2ccc(OC)c(OC)c2)cc1CO |
| InChI | InChI=1S/C22H34O5Si2/c1-24-20-8-6-18(14-19(20)16-23)11-13-29(4,5)27-28-12-10-17-7-9-21(25-2)22(15-17)26-3/h6-9,14-15,23H,10-13,16,28H2,1-5H3 |
| InChIKey | GEFISVROUWLAJK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|