C35H44O7 — CID 126699722
2-[2-[[10-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-methylphenyl]-2,7-dimethylphenanthren-9-yl]methoxy]ethoxy]ethanol (PubChem CID 126699722) has the molecular formula C35H44O7 and a molecular weight of 576.73 g/mol. Its IUPAC name is 2-[2-[[10-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-methylphenyl]-2,7-dimethylphenanthren-9-yl]methoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[10-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-methylphenyl]-2,7-dimethylphenanthren-9-yl]methoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 126699722 |
| Molecular Formula | C35H44O7 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | 2-[2-[[10-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-methylphenyl]-2,7-dimethylphenanthren-9-yl]methoxy]ethoxy]ethanol |
| SMILES | COCCOCCOCCOc1ccc(-c2c(COCCOCCO)c3cc(C)ccc3c3ccc(C)cc23)cc1C |
| InChI | InChI=1S/C35H44O7/c1-25-5-8-29-30-9-6-26(2)22-32(30)35(33(31(29)21-25)24-41-18-17-38-12-11-36)28-7-10-34(27(3)23-28)42-20-19-40-16-15-39-14-13-37-4/h5-10,21-23,36H,11-20,24H2,1-4H3 |
| InChIKey | HPWUXWSFNWQWCX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|