C24H36NO3+ — CID 158185379
[3-(2,5-dimethylphenyl)-5-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl-ethyl-dimethylazanium (PubChem CID 158185379) has the molecular formula C24H36NO3+ and a molecular weight of 386.56 g/mol. Its IUPAC name is [3-(2,5-dimethylphenyl)-5-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl-ethyl-dimethylazanium.
| Compound Name | [3-(2,5-dimethylphenyl)-5-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 158185379 |
| Molecular Formula | C24H36NO3+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | [3-(2,5-dimethylphenyl)-5-[2-(2-methoxyethoxy)ethoxy]phenyl]methyl-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)Cc1cc(OCCOCCOC)cc(-c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H36NO3/c1-7-25(4,5)18-21-15-22(24-14-19(2)8-9-20(24)3)17-23(16-21)28-13-12-27-11-10-26-6/h8-9,14-17H,7,10-13,18H2,1-6H3/q+1 |
| InChIKey | JHJFATMVZFRTOE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|