C31H46O10 — CID 161276237
[3-(2,5-dimethylphenyl)-5-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate (PubChem CID 161276237) has the molecular formula C31H46O10 and a molecular weight of 578.70 g/mol. Its IUPAC name is [3-(2,5-dimethylphenyl)-5-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate.
| Compound Name | [3-(2,5-dimethylphenyl)-5-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate |
|---|---|
| PubChem CID | 161276237 |
| Molecular Formula | C31H46O10 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | [3-(2,5-dimethylphenyl)-5-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOc1cc(COC=O)cc(-c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C31H46O10/c1-26-4-5-27(2)31(20-26)29-21-28(24-40-25-32)22-30(23-29)41-19-18-39-17-16-38-15-14-37-13-12-36-11-10-35-9-8-34-7-6-33-3/h4-5,20-23,25H,6-19,24H2,1-3H3 |
| InChIKey | FHTAEOZHQDJSFH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|