About 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene (PubChem CID 126699729) has the molecular formula C20H28O4
and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene.
Molecular Properties
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene |
| PubChem CID | 126699729 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene |
| SMILES | COCCOCCOCCOc1cc(C)cc2c(C)ccc(C)c12 |
| InChI | InChI=1S/C20H28O4/c1-15-13-18-16(2)5-6-17(3)20(18)19(14-15)24-12-11-23-10-9-22-8-7-21-4/h5-6,13-14H,7-12H2,1-4H3 |
| InChIKey | VEADKBXRAXOIQJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene?
The IUPAC name of 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene (CID 126699729) is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene.
What is the SMILES notation for 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene?
The canonical SMILES for 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene is COCCOCCOCCOc1cc(C)cc2c(C)ccc(C)c12.
What is the InChIKey of 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene?
The InChIKey is VEADKBXRAXOIQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O4/c1-15-13-18-16(2)5-6-17(3)20(18)19(14-15)24-12-11-23-10-9-22-8-7-21-4/h5-6,13-14H,7-12H2,1-4H3.
What are the key properties of 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene?
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene has a molecular weight of 332.44 g/mol, XLogP of 3.82, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3,5,8-trimethylnaphthalene is sourced from PubChem (CID 126699729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).