C16H19NO — CID 43189138
1-[4-(2,4-dimethylphenoxy)phenyl]ethanamine (PubChem CID 43189138) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenoxy)phenyl]ethanamine.
| Compound Name | 1-[4-(2,4-dimethylphenoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 43189138 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-[4-(2,4-dimethylphenoxy)phenyl]ethanamine |
| SMILES | Cc1ccc(Oc2ccc(C(C)N)cc2)c(C)c1 |
| InChI | InChI=1S/C16H19NO/c1-11-4-9-16(12(2)10-11)18-15-7-5-14(6-8-15)13(3)17/h4-10,13H,17H2,1-3H3 |
| InChIKey | GVSMWMNOTNJDAV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |