About (3,4-dimethoxyphenoxy) hypochlorite
(3,4-dimethoxyphenoxy) hypochlorite (PubChem CID 88615367) has the molecular formula C8H9ClO4
and a molecular weight of 204.61 g/mol. Its IUPAC name is (3,4-dimethoxyphenoxy) hypochlorite.
Molecular Properties
| Compound Name | (3,4-dimethoxyphenoxy) hypochlorite |
| PubChem CID | 88615367 |
| Molecular Formula | C8H9ClO4 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (3,4-dimethoxyphenoxy) hypochlorite |
| SMILES | COc1ccc(OOCl)cc1OC |
| InChI | InChI=1S/C8H9ClO4/c1-10-7-4-3-6(12-13-9)5-8(7)11-2/h3-5H,1-2H3 |
| InChIKey | RZFQJSINGUMWBJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethoxyphenoxy) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethoxyphenoxy) hypochlorite?
The IUPAC name of (3,4-dimethoxyphenoxy) hypochlorite (CID 88615367) is (3,4-dimethoxyphenoxy) hypochlorite.
What is the SMILES notation for (3,4-dimethoxyphenoxy) hypochlorite?
The canonical SMILES for (3,4-dimethoxyphenoxy) hypochlorite is COc1ccc(OOCl)cc1OC.
What is the InChIKey of (3,4-dimethoxyphenoxy) hypochlorite?
The InChIKey is RZFQJSINGUMWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO4/c1-10-7-4-3-6(12-13-9)5-8(7)11-2/h3-5H,1-2H3.
What are the key properties of (3,4-dimethoxyphenoxy) hypochlorite?
(3,4-dimethoxyphenoxy) hypochlorite has a molecular weight of 204.61 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethoxyphenoxy) hypochlorite is sourced from PubChem (CID 88615367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).