C24H36O6Si — CID 10765897
ditert-butyl-bis(3,4-dimethoxyphenoxy)silane (PubChem CID 10765897) has the molecular formula C24H36O6Si and a molecular weight of 448.63 g/mol. Its IUPAC name is ditert-butyl-bis(3,4-dimethoxyphenoxy)silane.
| Compound Name | ditert-butyl-bis(3,4-dimethoxyphenoxy)silane |
|---|---|
| PubChem CID | 10765897 |
| Molecular Formula | C24H36O6Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | ditert-butyl-bis(3,4-dimethoxyphenoxy)silane |
| SMILES | COc1ccc(O[Si](Oc2ccc(OC)c(OC)c2)(C(C)(C)C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H36O6Si/c1-23(2,3)31(24(4,5)6,29-17-11-13-19(25-7)21(15-17)27-9)30-18-12-14-20(26-8)22(16-18)28-10/h11-16H,1-10H3 |
| InChIKey | RDYIBRFIJQJPLR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|