C12H18F2O2Si — CID 71378695
tert-butyl-(3,4-dimethoxyphenyl)-difluorosilane (PubChem CID 71378695) has the molecular formula C12H18F2O2Si and a molecular weight of 260.36 g/mol. Its IUPAC name is tert-butyl-(3,4-dimethoxyphenyl)-difluorosilane.
| Compound Name | tert-butyl-(3,4-dimethoxyphenyl)-difluorosilane |
|---|---|
| PubChem CID | 71378695 |
| Molecular Formula | C12H18F2O2Si |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | tert-butyl-(3,4-dimethoxyphenyl)-difluorosilane |
| SMILES | COc1ccc([Si](F)(F)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C12H18F2O2Si/c1-12(2,3)17(13,14)9-6-7-10(15-4)11(8-9)16-5/h6-8H,1-5H3 |
| InChIKey | NDGVGDKHEGUJEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|