C19H26O5Si — CID 72697489
(3,4-dimethoxyphenyl)-dimethyl-(3,4,5-trimethoxyphenyl)silane (PubChem CID 72697489) has the molecular formula C19H26O5Si and a molecular weight of 362.50 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-dimethyl-(3,4,5-trimethoxyphenyl)silane.
| Compound Name | (3,4-dimethoxyphenyl)-dimethyl-(3,4,5-trimethoxyphenyl)silane |
|---|---|
| PubChem CID | 72697489 |
| Molecular Formula | C19H26O5Si |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (3,4-dimethoxyphenyl)-dimethyl-(3,4,5-trimethoxyphenyl)silane |
| SMILES | COc1ccc([Si](C)(C)c2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C19H26O5Si/c1-20-15-9-8-13(10-16(15)21-2)25(6,7)14-11-17(22-3)19(24-5)18(12-14)23-4/h8-12H,1-7H3 |
| InChIKey | BKQXVLUNWDHMGA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|