C28H34N2O — CID 141172178
4-[1-[4-(4-tert-butylphenyl)anilino]-3-methylbutyl]benzamide (PubChem CID 141172178) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[1-[4-(4-tert-butylphenyl)anilino]-3-methylbutyl]benzamide.
| Compound Name | 4-[1-[4-(4-tert-butylphenyl)anilino]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 141172178 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 4-[1-[4-(4-tert-butylphenyl)anilino]-3-methylbutyl]benzamide |
| SMILES | CC(C)CC(Nc1ccc(-c2ccc(C(C)(C)C)cc2)cc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C28H34N2O/c1-19(2)18-26(22-6-8-23(9-7-22)27(29)31)30-25-16-12-21(13-17-25)20-10-14-24(15-11-20)28(3,4)5/h6-17,19,26,30H,18H2,1-5H3,(H2,29,31) |
| InChIKey | CTISJWLKNJKMTD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |