C27H30FNO2 — CID 141128283
4-[1-[4-(4-fluorophenyl)-3-methylphenoxy]heptyl]benzamide (PubChem CID 141128283) has the molecular formula C27H30FNO2 and a molecular weight of 419.54 g/mol. Its IUPAC name is 4-[1-[4-(4-fluorophenyl)-3-methylphenoxy]heptyl]benzamide.
| Compound Name | 4-[1-[4-(4-fluorophenyl)-3-methylphenoxy]heptyl]benzamide |
|---|---|
| PubChem CID | 141128283 |
| Molecular Formula | C27H30FNO2 |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-[1-[4-(4-fluorophenyl)-3-methylphenoxy]heptyl]benzamide |
| SMILES | CCCCCCC(Oc1ccc(-c2ccc(F)cc2)c(C)c1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C27H30FNO2/c1-3-4-5-6-7-26(21-8-10-22(11-9-21)27(29)30)31-24-16-17-25(19(2)18-24)20-12-14-23(28)15-13-20/h8-18,26H,3-7H2,1-2H3,(H2,29,30) |
| InChIKey | UXYAEZXOCOPKNT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|