C27H33NO2S — CID 141148352
5-[1-[4-(4-tert-butylphenyl)-3-methylphenoxy]pentyl]thiophene-2-carboxamide (PubChem CID 141148352) has the molecular formula C27H33NO2S and a molecular weight of 435.63 g/mol. Its IUPAC name is 5-[1-[4-(4-tert-butylphenyl)-3-methylphenoxy]pentyl]thiophene-2-carboxamide.
| Compound Name | 5-[1-[4-(4-tert-butylphenyl)-3-methylphenoxy]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141148352 |
| Molecular Formula | C27H33NO2S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 5-[1-[4-(4-tert-butylphenyl)-3-methylphenoxy]pentyl]thiophene-2-carboxamide |
| SMILES | CCCCC(Oc1ccc(-c2ccc(C(C)(C)C)cc2)c(C)c1)c1ccc(C(N)=O)s1 |
| InChI | InChI=1S/C27H33NO2S/c1-6-7-8-23(24-15-16-25(31-24)26(28)29)30-21-13-14-22(18(2)17-21)19-9-11-20(12-10-19)27(3,4)5/h9-17,23H,6-8H2,1-5H3,(H2,28,29) |
| InChIKey | APKWGMFMFBYSRD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |