C30H35F3O5S2 — CID 158678932
4-[5-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid (PubChem CID 158678932) has the molecular formula C30H35F3O5S2 and a molecular weight of 596.73 g/mol. Its IUPAC name is 4-[5-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid.
| Compound Name | 4-[5-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 158678932 |
| Molecular Formula | C30H35F3O5S2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 4-[5-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]thiophen-2-yl]-4-oxobutane-1-sulfonic acid |
| SMILES | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)CCCS(=O)(=O)O)s2)cc(C)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H35F3O5S2/c1-19-17-23(18-20(2)28(19)21-8-10-22(11-9-21)29(3,4)5)38-25(14-15-30(31,32)33)27-13-12-26(39-27)24(34)7-6-16-40(35,36)37/h8-13,17-18,25H,6-7,14-16H2,1-5H3,(H,35,36,37)/t25-/m0/s1 |
| InChIKey | IEWHZNAIJXJFDG-VWLOTQADSA-N |
| XLogP | 8.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|