C31H36F3NO5S — CID 134265393
2-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 134265393) has the molecular formula C31H36F3NO5S and a molecular weight of 591.69 g/mol. Its IUPAC name is 2-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134265393 |
| Molecular Formula | C31H36F3NO5S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 2-[[4-[(1S)-1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)NCCS(=O)(=O)O)cc2)cc(C)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H36F3NO5S/c1-20-18-26(19-21(2)28(20)23-10-12-25(13-11-23)30(3,4)5)40-27(14-15-31(32,33)34)22-6-8-24(9-7-22)29(36)35-16-17-41(37,38)39/h6-13,18-19,27H,14-17H2,1-5H3,(H,35,36)(H,37,38,39)/t27-/m0/s1 |
| InChIKey | HWDQKHSXEKVKBI-MHZLTWQESA-N |
| XLogP | 7.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|