C25H28F3N3O5S — CID 134265009
2-[[4-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 134265009) has the molecular formula C25H28F3N3O5S and a molecular weight of 539.58 g/mol. Its IUPAC name is 2-[[4-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134265009 |
| Molecular Formula | C25H28F3N3O5S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-[[4-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CCCC(Oc1cc(C)c(-n2cc(C(F)(F)F)cn2)c(C)c1)c1ccc(C(=O)NCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H28F3N3O5S/c1-4-5-22(18-6-8-19(9-7-18)24(32)29-10-11-37(33,34)35)36-21-12-16(2)23(17(3)13-21)31-15-20(14-30-31)25(26,27)28/h6-9,12-15,22H,4-5,10-11H2,1-3H3,(H,29,32)(H,33,34,35) |
| InChIKey | PLQGBVXDAUXBRJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|