C28H34N2O5S — CID 44818379
2-[[4-[1-[[6-[4-(2-methylpropyl)phenyl]-3-pyridinyl]oxy]butyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 44818379) has the molecular formula C28H34N2O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[[4-[1-[[6-[4-(2-methylpropyl)phenyl]-3-pyridinyl]oxy]butyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[1-[[6-[4-(2-methylpropyl)phenyl]-3-pyridinyl]oxy]butyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 44818379 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-[[4-[1-[[6-[4-(2-methylpropyl)phenyl]-3-pyridinyl]oxy]butyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CCCC(Oc1ccc(-c2ccc(CC(C)C)cc2)nc1)c1ccc(C(=O)NCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H34N2O5S/c1-4-5-27(23-10-12-24(13-11-23)28(31)29-16-17-36(32,33)34)35-25-14-15-26(30-19-25)22-8-6-21(7-9-22)18-20(2)3/h6-15,19-20,27H,4-5,16-18H2,1-3H3,(H,29,31)(H,32,33,34) |
| InChIKey | OGOVJIBJPRKFHT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|