C31H36F3N5O2 — CID 67490375
N-[2-(aminodiazenyl)-2-iminoethyl]-4-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzamide (PubChem CID 67490375) has the molecular formula C31H36F3N5O2 and a molecular weight of 567.66 g/mol. Its IUPAC name is N-[2-(aminodiazenyl)-2-iminoethyl]-4-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzamide.
| Compound Name | N-[2-(aminodiazenyl)-2-iminoethyl]-4-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzamide |
|---|---|
| PubChem CID | 67490375 |
| Molecular Formula | C31H36F3N5O2 |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | N-[2-(aminodiazenyl)-2-iminoethyl]-4-[1-[4-(4-tert-butylphenyl)-3,5-dimethylphenoxy]-4,4,4-trifluorobutyl]benzamide |
| SMILES | [H]/N=C(CNC(=O)c1ccc(C(CCC(F)(F)F)Oc2cc(C)c(-c3ccc(C(C)(C)C)cc3)c(C)c2)cc1)\N=N\N |
| InChI | InChI=1S/C31H36F3N5O2/c1-19-16-25(17-20(2)28(19)22-10-12-24(13-11-22)30(3,4)5)41-26(14-15-31(32,33)34)21-6-8-23(9-7-21)29(40)37-18-27(35)38-39-36/h6-13,16-17,26H,14-15,18H2,1-5H3,(H,37,40)(H3,35,36,38) |
| InChIKey | IUMUSALYSRXHNN-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|